C19H46N2O3Si2 — CID 87069481
N-[3-[diethoxy(methyl)silyl]propyl]-N'-(2-ethoxyethyl)-N-ethyl-N'-trimethylsilylethane-1,2-diamine (PubChem CID 87069481) has the molecular formula C19H46N2O3Si2 and a molecular weight of 406.76 g/mol. Its IUPAC name is N-[3-[diethoxy(methyl)silyl]propyl]-N'-(2-ethoxyethyl)-N-ethyl-N'-trimethylsilylethane-1,2-diamine.
| Compound Name | N-[3-[diethoxy(methyl)silyl]propyl]-N'-(2-ethoxyethyl)-N-ethyl-N'-trimethylsilylethane-1,2-diamine |
|---|---|
| PubChem CID | 87069481 |
| Molecular Formula | C19H46N2O3Si2 |
| Molecular Weight | 406.76 g/mol |
| Exact Mass | 406.30 |
| IUPAC Name | N-[3-[diethoxy(methyl)silyl]propyl]-N'-(2-ethoxyethyl)-N-ethyl-N'-trimethylsilylethane-1,2-diamine |
| SMILES | CCOCCN(CCN(CC)CCC[Si](C)(OCC)OCC)[Si](C)(C)C |
| InChI | InChI=1S/C19H46N2O3Si2/c1-9-20(14-13-19-26(8,23-11-3)24-12-4)15-16-21(25(5,6)7)17-18-22-10-2/h9-19H2,1-8H3 |
| InChIKey | PSXNMMCJSKZZRL-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.76 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|