C14H33NO3Si — CID 90074831
3-[2-[diethoxy(methyl)silyl]ethoxy]-N,N-diethylpropan-1-amine (PubChem CID 90074831) has the molecular formula C14H33NO3Si and a molecular weight of 291.51 g/mol. Its IUPAC name is 3-[2-[diethoxy(methyl)silyl]ethoxy]-N,N-diethylpropan-1-amine.
| Compound Name | 3-[2-[diethoxy(methyl)silyl]ethoxy]-N,N-diethylpropan-1-amine |
|---|---|
| PubChem CID | 90074831 |
| Molecular Formula | C14H33NO3Si |
| Molecular Weight | 291.51 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | 3-[2-[diethoxy(methyl)silyl]ethoxy]-N,N-diethylpropan-1-amine |
| SMILES | CCO[Si](C)(CCOCCCN(CC)CC)OCC |
| InChI | InChI=1S/C14H33NO3Si/c1-6-15(7-2)11-10-12-16-13-14-19(5,17-8-3)18-9-4/h6-14H2,1-5H3 |
| InChIKey | UIYOVMXZBBOSQG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.51 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|