C13H31NO3Si — CID 90074863
3-[2-[diethoxy(ethyl)silyl]ethoxy]-N,N-dimethylpropan-1-amine (PubChem CID 90074863) has the molecular formula C13H31NO3Si and a molecular weight of 277.48 g/mol. Its IUPAC name is 3-[2-[diethoxy(ethyl)silyl]ethoxy]-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[2-[diethoxy(ethyl)silyl]ethoxy]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 90074863 |
| Molecular Formula | C13H31NO3Si |
| Molecular Weight | 277.48 g/mol |
| Exact Mass | 277.21 |
| IUPAC Name | 3-[2-[diethoxy(ethyl)silyl]ethoxy]-N,N-dimethylpropan-1-amine |
| SMILES | CCO[Si](CC)(CCOCCCN(C)C)OCC |
| InChI | InChI=1S/C13H31NO3Si/c1-6-16-18(8-3,17-7-2)13-12-15-11-9-10-14(4)5/h6-13H2,1-5H3 |
| InChIKey | XKVLLROIUFHEGG-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.48 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|