C19H43NO3Si2 — CID 88852245
tri(propan-2-yl)silyl 3-[3-[methoxy(dimethyl)silyl]propylamino]-2-methylpropanoate (PubChem CID 88852245) has the molecular formula C19H43NO3Si2 and a molecular weight of 389.73 g/mol. Its IUPAC name is tri(propan-2-yl)silyl 3-[3-[methoxy(dimethyl)silyl]propylamino]-2-methylpropanoate.
| Compound Name | tri(propan-2-yl)silyl 3-[3-[methoxy(dimethyl)silyl]propylamino]-2-methylpropanoate |
|---|---|
| PubChem CID | 88852245 |
| Molecular Formula | C19H43NO3Si2 |
| Molecular Weight | 389.73 g/mol |
| Exact Mass | 389.28 |
| IUPAC Name | tri(propan-2-yl)silyl 3-[3-[methoxy(dimethyl)silyl]propylamino]-2-methylpropanoate |
| SMILES | CO[Si](C)(C)CCCNCC(C)C(=O)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C19H43NO3Si2/c1-15(2)25(16(3)4,17(5)6)23-19(21)18(7)14-20-12-11-13-24(9,10)22-8/h15-18,20H,11-14H2,1-10H3 |
| InChIKey | IOGUTPXZQDEKDD-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.73 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|