C17H39NO3Si2 — CID 88852191
[tert-butyl(dimethyl)silyl] 3-[ethyl-[3-[methoxy(dimethyl)silyl]propyl]amino]propanoate (PubChem CID 88852191) has the molecular formula C17H39NO3Si2 and a molecular weight of 361.68 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] 3-[ethyl-[3-[methoxy(dimethyl)silyl]propyl]amino]propanoate.
| Compound Name | [tert-butyl(dimethyl)silyl] 3-[ethyl-[3-[methoxy(dimethyl)silyl]propyl]amino]propanoate |
|---|---|
| PubChem CID | 88852191 |
| Molecular Formula | C17H39NO3Si2 |
| Molecular Weight | 361.68 g/mol |
| Exact Mass | 361.25 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] 3-[ethyl-[3-[methoxy(dimethyl)silyl]propyl]amino]propanoate |
| SMILES | CCN(CCC[Si](C)(C)OC)CCC(=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H39NO3Si2/c1-10-18(13-11-15-22(6,7)20-5)14-12-16(19)21-23(8,9)17(2,3)4/h10-15H2,1-9H3 |
| InChIKey | KCUDDUYJNVRVLK-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.68 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|