About 3-[ethoxy(dimethyl)silyl]propyl (2S)-2-bromopropanoate
3-[ethoxy(dimethyl)silyl]propyl (2S)-2-bromopropanoate (PubChem CID 124675355) has the molecular formula C10H21BrO3Si
and a molecular weight of 297.26 g/mol. Its IUPAC name is 3-[ethoxy(dimethyl)silyl]propyl (2S)-2-bromopropanoate.
Molecular Properties
| Compound Name | 3-[ethoxy(dimethyl)silyl]propyl (2S)-2-bromopropanoate |
| PubChem CID | 124675355 |
| Molecular Formula | C10H21BrO3Si |
| Molecular Weight | 297.26 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 3-[ethoxy(dimethyl)silyl]propyl (2S)-2-bromopropanoate |
| SMILES | CCO[Si](C)(C)CCCOC(=O)[C@H](C)Br |
| InChI | InChI=1S/C10H21BrO3Si/c1-5-14-15(3,4)8-6-7-13-10(12)9(2)11/h9H,5-8H2,1-4H3/t9-/m0/s1 |
| InChIKey | ULFQZIIVESRZPK-VIFPVBQESA-N |
| XLogP | 2.94 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.26 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-[ethoxy(dimethyl)silyl]propyl (2S)-2-bromopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[ethoxy(dimethyl)silyl]propyl (2S)-2-bromopropanoate?
The IUPAC name of 3-[ethoxy(dimethyl)silyl]propyl (2S)-2-bromopropanoate (CID 124675355) is 3-[ethoxy(dimethyl)silyl]propyl (2S)-2-bromopropanoate.
What is the SMILES notation for 3-[ethoxy(dimethyl)silyl]propyl (2S)-2-bromopropanoate?
The canonical SMILES for 3-[ethoxy(dimethyl)silyl]propyl (2S)-2-bromopropanoate is CCO[Si](C)(C)CCCOC(=O)[C@H](C)Br.
What is the InChIKey of 3-[ethoxy(dimethyl)silyl]propyl (2S)-2-bromopropanoate?
The InChIKey is ULFQZIIVESRZPK-VIFPVBQESA-N. The full InChI is InChI=1S/C10H21BrO3Si/c1-5-14-15(3,4)8-6-7-13-10(12)9(2)11/h9H,5-8H2,1-4H3/t9-/m0/s1.
What are the key properties of 3-[ethoxy(dimethyl)silyl]propyl (2S)-2-bromopropanoate?
3-[ethoxy(dimethyl)silyl]propyl (2S)-2-bromopropanoate has a molecular weight of 297.26 g/mol, XLogP of 2.94, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[ethoxy(dimethyl)silyl]propyl (2S)-2-bromopropanoate is sourced from PubChem (CID 124675355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).