C3H3F3O — CID 88605986
(E)-2,3,3-trifluoroprop-1-en-1-ol (PubChem CID 88605986) has the molecular formula C3H3F3O and a molecular weight of 112.05 g/mol. Its IUPAC name is (E)-2,3,3-trifluoroprop-1-en-1-ol.
| Compound Name | (E)-2,3,3-trifluoroprop-1-en-1-ol |
|---|---|
| PubChem CID | 88605986 |
| Molecular Formula | C3H3F3O |
| Molecular Weight | 112.05 g/mol |
| Exact Mass | 112.01 |
| IUPAC Name | (E)-2,3,3-trifluoroprop-1-en-1-ol |
| SMILES | O/C=C(/F)C(F)F |
| InChI | InChI=1S/C3H3F3O/c4-2(1-7)3(5)6/h1,3,7H/b2-1+ |
| InChIKey | WNNJVYRYGGYIKK-OWOJBTEDSA-N |
| XLogP | 1.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.05 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|