C8H6F10 — CID 161312912
1,1,2,4,4-pentafluorobut-2-ene (PubChem CID 161312912) has the molecular formula C8H6F10 and a molecular weight of 292.12 g/mol. Its IUPAC name is 1,1,2,4,4-pentafluorobut-2-ene.
| Compound Name | 1,1,2,4,4-pentafluorobut-2-ene |
|---|---|
| PubChem CID | 161312912 |
| Molecular Formula | C8H6F10 |
| Molecular Weight | 292.12 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | 1,1,2,4,4-pentafluorobut-2-ene |
| SMILES | FC(=CC(F)F)C(F)F.FC(=CC(F)F)C(F)F |
| InChI | InChI=1S/2C4H3F5/c2*5-2(4(8)9)1-3(6)7/h2*1,3-4H |
| InChIKey | VJCWOQGHNOJOFD-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.12 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |