C4H2F3N — CID 174282316
(Z)-2,4,4-trifluorobut-2-enenitrile (PubChem CID 174282316) has the molecular formula C4H2F3N and a molecular weight of 121.06 g/mol. Its IUPAC name is (Z)-2,4,4-trifluorobut-2-enenitrile.
| Compound Name | (Z)-2,4,4-trifluorobut-2-enenitrile |
|---|---|
| PubChem CID | 174282316 |
| Molecular Formula | C4H2F3N |
| Molecular Weight | 121.06 g/mol |
| Exact Mass | 121.01 |
| IUPAC Name | (Z)-2,4,4-trifluorobut-2-enenitrile |
| SMILES | N#C/C(F)=C/C(F)F |
| InChI | InChI=1S/C4H2F3N/c5-3(2-8)1-4(6)7/h1,4H/b3-1- |
| InChIKey | CNGBJJPWARFDSR-IWQZZHSRSA-N |
| XLogP | 1.63 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.06 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|