C9H3FN4 — CID 15866330
(3Z)-3-fluoropenta-1,3-diene-1,1,5,5-tetracarbonitrile (PubChem CID 15866330) has the molecular formula C9H3FN4 and a molecular weight of 186.15 g/mol. Its IUPAC name is (3Z)-3-fluoropenta-1,3-diene-1,1,5,5-tetracarbonitrile.
| Compound Name | (3Z)-3-fluoropenta-1,3-diene-1,1,5,5-tetracarbonitrile |
|---|---|
| PubChem CID | 15866330 |
| Molecular Formula | C9H3FN4 |
| Molecular Weight | 186.15 g/mol |
| Exact Mass | 186.03 |
| IUPAC Name | (3Z)-3-fluoropenta-1,3-diene-1,1,5,5-tetracarbonitrile |
| SMILES | N#CC(C#N)=C/C(F)=C/C(C#N)C#N |
| InChI | InChI=1S/C9H3FN4/c10-9(1-7(3-11)4-12)2-8(5-13)6-14/h1-2,7H/b9-1- |
| InChIKey | VLHBRQLVFKWELZ-OQYWKCLKSA-N |
| XLogP | 1.48 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.15 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|