C11H6N4 — CID 14273405
(3E,5E)-hepta-1,3,5-triene-1,1,7,7-tetracarbonitrile (PubChem CID 14273405) has the molecular formula C11H6N4 and a molecular weight of 194.20 g/mol. Its IUPAC name is (3E,5E)-hepta-1,3,5-triene-1,1,7,7-tetracarbonitrile.
| Compound Name | (3E,5E)-hepta-1,3,5-triene-1,1,7,7-tetracarbonitrile |
|---|---|
| PubChem CID | 14273405 |
| Molecular Formula | C11H6N4 |
| Molecular Weight | 194.20 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | (3E,5E)-hepta-1,3,5-triene-1,1,7,7-tetracarbonitrile |
| SMILES | N#CC(C#N)=C/C=C/C=C/C(C#N)C#N |
| InChI | InChI=1S/C11H6N4/c12-6-10(7-13)4-2-1-3-5-11(8-14)9-15/h1-5,10H/b3-1+,4-2+ |
| InChIKey | UKFNRPAEPZWYCG-ZPUQHVIOSA-N |
| XLogP | 1.74 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.20 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|