C10H7BrN2O — CID 163800941
2-[(2E,4E,6E)-7-bromo-7-hydroxyhepta-2,4,6-trienylidene]propanedinitrile (PubChem CID 163800941) has the molecular formula C10H7BrN2O and a molecular weight of 251.08 g/mol. Its IUPAC name is 2-[(2E,4E,6E)-7-bromo-7-hydroxyhepta-2,4,6-trienylidene]propanedinitrile.
| Compound Name | 2-[(2E,4E,6E)-7-bromo-7-hydroxyhepta-2,4,6-trienylidene]propanedinitrile |
|---|---|
| PubChem CID | 163800941 |
| Molecular Formula | C10H7BrN2O |
| Molecular Weight | 251.08 g/mol |
| Exact Mass | 249.97 |
| IUPAC Name | 2-[(2E,4E,6E)-7-bromo-7-hydroxyhepta-2,4,6-trienylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C/C=C/C=C/C=C(\O)Br |
| InChI | InChI=1S/C10H7BrN2O/c11-10(14)6-4-2-1-3-5-9(7-12)8-13/h1-6,14H/b3-1+,4-2+,10-6- |
| InChIKey | NEWVSFJQZGKIAA-HPZAJUQXSA-N |
| XLogP | 2.87 |
| TPSA | 67.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.08 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|