C6H6BrN — CID 24851488
(2Z,4E)-2-bromohexa-2,4-dienenitrile (PubChem CID 24851488) has the molecular formula C6H6BrN and a molecular weight of 172.02 g/mol. Its IUPAC name is (2Z,4E)-2-bromohexa-2,4-dienenitrile.
| Compound Name | (2Z,4E)-2-bromohexa-2,4-dienenitrile |
|---|---|
| PubChem CID | 24851488 |
| Molecular Formula | C6H6BrN |
| Molecular Weight | 172.02 g/mol |
| Exact Mass | 170.97 |
| IUPAC Name | (2Z,4E)-2-bromohexa-2,4-dienenitrile |
| SMILES | C/C=C/C=C(\Br)C#N |
| InChI | InChI=1S/C6H6BrN/c1-2-3-4-6(7)5-8/h2-4H,1H3/b3-2+,6-4- |
| InChIKey | XSPSIPQOHQUWFA-ZPYFUIHZSA-N |
| XLogP | 2.36 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.02 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|