C12H19NO — CID 139442716
[(2Z,4E)-6,7-dimethylnona-2,4-dien-5-yl] cyanate (PubChem CID 139442716) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is [(2Z,4E)-6,7-dimethylnona-2,4-dien-5-yl] cyanate.
| Compound Name | [(2Z,4E)-6,7-dimethylnona-2,4-dien-5-yl] cyanate |
|---|---|
| PubChem CID | 139442716 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | [(2Z,4E)-6,7-dimethylnona-2,4-dien-5-yl] cyanate |
| SMILES | C/C=C\C=C(\OC#N)C(C)C(C)CC |
| InChI | InChI=1S/C12H19NO/c1-5-7-8-12(14-9-13)11(4)10(3)6-2/h5,7-8,10-11H,6H2,1-4H3/b7-5-,12-8+ |
| InChIKey | OTYKZXJOUZLPJL-BAIUDDDUSA-N |
| XLogP | 3.63 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|