C14H24O — CID 143462641
(2Z,4E,6Z)-4-(3-methylpentan-2-yloxy)octa-2,4,6-triene (PubChem CID 143462641) has the molecular formula C14H24O and a molecular weight of 208.34 g/mol. Its IUPAC name is (2Z,4E,6Z)-4-(3-methylpentan-2-yloxy)octa-2,4,6-triene.
| Compound Name | (2Z,4E,6Z)-4-(3-methylpentan-2-yloxy)octa-2,4,6-triene |
|---|---|
| PubChem CID | 143462641 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | (2Z,4E,6Z)-4-(3-methylpentan-2-yloxy)octa-2,4,6-triene |
| SMILES | C/C=C\C=C(/C=C\C)OC(C)C(C)CC |
| InChI | InChI=1S/C14H24O/c1-6-9-11-14(10-7-2)15-13(5)12(4)8-3/h6-7,9-13H,8H2,1-5H3/b9-6-,10-7-,14-11+ |
| InChIKey | SWFIUZQKACOPNL-QASJPRHKSA-N |
| XLogP | 4.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|