About (2E,4E)-5-ethyl-7-methylocta-2,4-diene
(2E,4E)-5-ethyl-7-methylocta-2,4-diene (PubChem CID 173194163) has the molecular formula C11H20
and a molecular weight of 152.28 g/mol. Its IUPAC name is (2E,4E)-5-ethyl-7-methylocta-2,4-diene.
Molecular Properties
| Compound Name | (2E,4E)-5-ethyl-7-methylocta-2,4-diene |
| PubChem CID | 173194163 |
| Molecular Formula | C11H20 |
| Molecular Weight | 152.28 g/mol |
| Exact Mass | 152.16 |
| IUPAC Name | (2E,4E)-5-ethyl-7-methylocta-2,4-diene |
| SMILES | C/C=C/C=C(\CC)CC(C)C |
| InChI | InChI=1S/C11H20/c1-5-7-8-11(6-2)9-10(3)4/h5,7-8,10H,6,9H2,1-4H3/b7-5+,11-8+ |
| InChIKey | ZIRZGACJKGRAOV-PAQHSLSSSA-N |
| XLogP | 3.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.28 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4E)-5-ethyl-7-methylocta-2,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4E)-5-ethyl-7-methylocta-2,4-diene?
The IUPAC name of (2E,4E)-5-ethyl-7-methylocta-2,4-diene (CID 173194163) is (2E,4E)-5-ethyl-7-methylocta-2,4-diene.
What is the SMILES notation for (2E,4E)-5-ethyl-7-methylocta-2,4-diene?
The canonical SMILES for (2E,4E)-5-ethyl-7-methylocta-2,4-diene is C/C=C/C=C(\CC)CC(C)C.
What is the InChIKey of (2E,4E)-5-ethyl-7-methylocta-2,4-diene?
The InChIKey is ZIRZGACJKGRAOV-PAQHSLSSSA-N. The full InChI is InChI=1S/C11H20/c1-5-7-8-11(6-2)9-10(3)4/h5,7-8,10H,6,9H2,1-4H3/b7-5+,11-8+.
What are the key properties of (2E,4E)-5-ethyl-7-methylocta-2,4-diene?
(2E,4E)-5-ethyl-7-methylocta-2,4-diene has a molecular weight of 152.28 g/mol, XLogP of 3.94, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4E)-5-ethyl-7-methylocta-2,4-diene is sourced from PubChem (CID 173194163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).