C18H38O — CID 143380177
ethane;(2Z,4E)-5-(2-methoxyethyl)octa-2,4-diene;2-methylbutane (PubChem CID 143380177) has the molecular formula C18H38O and a molecular weight of 270.50 g/mol. Its IUPAC name is ethane;(2Z,4E)-5-(2-methoxyethyl)octa-2,4-diene;2-methylbutane.
| Compound Name | ethane;(2Z,4E)-5-(2-methoxyethyl)octa-2,4-diene;2-methylbutane |
|---|---|
| PubChem CID | 143380177 |
| Molecular Formula | C18H38O |
| Molecular Weight | 270.50 g/mol |
| Exact Mass | 270.29 |
| IUPAC Name | ethane;(2Z,4E)-5-(2-methoxyethyl)octa-2,4-diene;2-methylbutane |
| SMILES | C/C=C\C=C(/CCC)CCOC.CC.CCC(C)C |
| InChI | InChI=1S/C11H20O.C5H12.C2H6/c1-4-6-8-11(7-5-2)9-10-12-3;1-4-5(2)3;1-2/h4,6,8H,5,7,9-10H2,1-3H3;5H,4H2,1-3H3;1-2H3/b6-4-,11-8+;; |
| InChIKey | JOSDVUQCSWTFQE-ADWOKGRPSA-N |
| XLogP | 6.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.50 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|