C21H40O3 — CID 146358244
(2Z,4E)-5-[2-(5-pentoxypentoxy)ethoxymethyl]octa-2,4-diene (PubChem CID 146358244) has the molecular formula C21H40O3 and a molecular weight of 340.55 g/mol. Its IUPAC name is (2Z,4E)-5-[2-(5-pentoxypentoxy)ethoxymethyl]octa-2,4-diene.
| Compound Name | (2Z,4E)-5-[2-(5-pentoxypentoxy)ethoxymethyl]octa-2,4-diene |
|---|---|
| PubChem CID | 146358244 |
| Molecular Formula | C21H40O3 |
| Molecular Weight | 340.55 g/mol |
| Exact Mass | 340.30 |
| IUPAC Name | (2Z,4E)-5-[2-(5-pentoxypentoxy)ethoxymethyl]octa-2,4-diene |
| SMILES | C/C=C\C=C(/CCC)COCCOCCCCCOCCCCC |
| InChI | InChI=1S/C21H40O3/c1-4-7-10-15-22-16-11-9-12-17-23-18-19-24-20-21(13-6-3)14-8-5-2/h5,8,14H,4,6-7,9-13,15-20H2,1-3H3/b8-5-,21-14+ |
| InChIKey | CSAHIHVAMUOZQK-GLKHCROLSA-N |
| XLogP | 5.70 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.55 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|