C20H40O3 — CID 71375550
1,4-dioctoxybutan-2-one (PubChem CID 71375550) has the molecular formula C20H40O3 and a molecular weight of 328.54 g/mol. Its IUPAC name is 1,4-dioctoxybutan-2-one.
| Compound Name | 1,4-dioctoxybutan-2-one |
|---|---|
| PubChem CID | 71375550 |
| Molecular Formula | C20H40O3 |
| Molecular Weight | 328.54 g/mol |
| Exact Mass | 328.30 |
| IUPAC Name | 1,4-dioctoxybutan-2-one |
| SMILES | CCCCCCCCOCCC(=O)COCCCCCCCC |
| InChI | InChI=1S/C20H40O3/c1-3-5-7-9-11-13-16-22-18-15-20(21)19-23-17-14-12-10-8-6-4-2/h3-19H2,1-2H3 |
| InChIKey | OJJLTKOZBLSXQO-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.54 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|