About 1-methoxy-3-methylbutane;2-methylbutane;2-methylpropane
1-methoxy-3-methylbutane;2-methylbutane;2-methylpropane (PubChem CID 158816620) has the molecular formula C15H36O
and a molecular weight of 232.45 g/mol. Its IUPAC name is 1-methoxy-3-methylbutane;2-methylbutane;2-methylpropane.
Molecular Properties
| Compound Name | 1-methoxy-3-methylbutane;2-methylbutane;2-methylpropane |
| PubChem CID | 158816620 |
| Molecular Formula | C15H36O |
| Molecular Weight | 232.45 g/mol |
| Exact Mass | 232.28 |
| IUPAC Name | 1-methoxy-3-methylbutane;2-methylbutane;2-methylpropane |
| SMILES | CC(C)C.CCC(C)C.COCCC(C)C |
| InChI | InChI=1S/C6H14O.C5H12.C4H10/c1-6(2)4-5-7-3;1-4-5(2)3;1-4(2)3/h6H,4-5H2,1-3H3;5H,4H2,1-3H3;4H,1-3H3 |
| InChIKey | IVIVHGCDCDRELL-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 232.45 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-methoxy-3-methylbutane;2-methylbutane;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-3-methylbutane;2-methylbutane;2-methylpropane?
The IUPAC name of 1-methoxy-3-methylbutane;2-methylbutane;2-methylpropane (CID 158816620) is 1-methoxy-3-methylbutane;2-methylbutane;2-methylpropane.
What is the SMILES notation for 1-methoxy-3-methylbutane;2-methylbutane;2-methylpropane?
The canonical SMILES for 1-methoxy-3-methylbutane;2-methylbutane;2-methylpropane is CC(C)C.CCC(C)C.COCCC(C)C.
What is the InChIKey of 1-methoxy-3-methylbutane;2-methylbutane;2-methylpropane?
The InChIKey is IVIVHGCDCDRELL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O.C5H12.C4H10/c1-6(2)4-5-7-3;1-4-5(2)3;1-4(2)3/h6H,4-5H2,1-3H3;5H,4H2,1-3H3;4H,1-3H3.
What are the key properties of 1-methoxy-3-methylbutane;2-methylbutane;2-methylpropane?
1-methoxy-3-methylbutane;2-methylbutane;2-methylpropane has a molecular weight of 232.45 g/mol, XLogP of 5.39, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-3-methylbutane;2-methylbutane;2-methylpropane is sourced from PubChem (CID 158816620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).