C9H15NO2 — CID 123678203
2-ethylhexa-2,4-dienyl carbamate (PubChem CID 123678203) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is 2-ethylhexa-2,4-dienyl carbamate.
| Compound Name | 2-ethylhexa-2,4-dienyl carbamate |
|---|---|
| PubChem CID | 123678203 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | 2-ethylhexa-2,4-dienyl carbamate |
| SMILES | CC=CC=C(CC)COC(N)=O |
| InChI | InChI=1S/C9H15NO2/c1-3-5-6-8(4-2)7-12-9(10)11/h3,5-6H,4,7H2,1-2H3,(H2,10,11) |
| InChIKey | AWHUGVJENOSSHY-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|