About ethane;(Z)-3-ethyl-5-methylhex-2-ene;methanamine
ethane;(Z)-3-ethyl-5-methylhex-2-ene;methanamine (PubChem CID 143325011) has the molecular formula C14H35N
and a molecular weight of 217.44 g/mol. Its IUPAC name is ethane;(Z)-3-ethyl-5-methylhex-2-ene;methanamine.
Molecular Properties
| Compound Name | ethane;(Z)-3-ethyl-5-methylhex-2-ene;methanamine |
| PubChem CID | 143325011 |
| Molecular Formula | C14H35N |
| Molecular Weight | 217.44 g/mol |
| Exact Mass | 217.28 |
| IUPAC Name | ethane;(Z)-3-ethyl-5-methylhex-2-ene;methanamine |
| SMILES | C/C=C(/CC)CC(C)C.CC.CC.CN |
| InChI | InChI=1S/C9H18.2C2H6.CH5N/c1-5-9(6-2)7-8(3)4;3*1-2/h5,8H,6-7H2,1-4H3;2*1-2H3;2H2,1H3/b9-5-;;; |
| InChIKey | FXAKSKXBEIGMFR-WNRDOTPUSA-N |
| XLogP | 5.02 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 217.44 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;(Z)-3-ethyl-5-methylhex-2-ene;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(Z)-3-ethyl-5-methylhex-2-ene;methanamine?
The IUPAC name of ethane;(Z)-3-ethyl-5-methylhex-2-ene;methanamine (CID 143325011) is ethane;(Z)-3-ethyl-5-methylhex-2-ene;methanamine.
What is the SMILES notation for ethane;(Z)-3-ethyl-5-methylhex-2-ene;methanamine?
The canonical SMILES for ethane;(Z)-3-ethyl-5-methylhex-2-ene;methanamine is C/C=C(/CC)CC(C)C.CC.CC.CN.
What is the InChIKey of ethane;(Z)-3-ethyl-5-methylhex-2-ene;methanamine?
The InChIKey is FXAKSKXBEIGMFR-WNRDOTPUSA-N. The full InChI is InChI=1S/C9H18.2C2H6.CH5N/c1-5-9(6-2)7-8(3)4;3*1-2/h5,8H,6-7H2,1-4H3;2*1-2H3;2H2,1H3/b9-5-;;;.
What are the key properties of ethane;(Z)-3-ethyl-5-methylhex-2-ene;methanamine?
ethane;(Z)-3-ethyl-5-methylhex-2-ene;methanamine has a molecular weight of 217.44 g/mol, XLogP of 5.02, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(Z)-3-ethyl-5-methylhex-2-ene;methanamine is sourced from PubChem (CID 143325011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).