About ethane;(Z)-3-ethyl-7-methyl-6-methylideneoct-2-ene;prop-1-ene
ethane;(Z)-3-ethyl-7-methyl-6-methylideneoct-2-ene;prop-1-ene (PubChem CID 178040036) has the molecular formula C19H40
and a molecular weight of 268.53 g/mol. Its IUPAC name is ethane;(Z)-3-ethyl-7-methyl-6-methylideneoct-2-ene;prop-1-ene.
Molecular Properties
| Compound Name | ethane;(Z)-3-ethyl-7-methyl-6-methylideneoct-2-ene;prop-1-ene |
| PubChem CID | 178040036 |
| Molecular Formula | C19H40 |
| Molecular Weight | 268.53 g/mol |
| Exact Mass | 268.31 |
| IUPAC Name | ethane;(Z)-3-ethyl-7-methyl-6-methylideneoct-2-ene;prop-1-ene |
| SMILES | C=C(CC/C(=C\C)CC)C(C)C.C=CC.CC.CC |
| InChI | InChI=1S/C12H22.C3H6.2C2H6/c1-6-12(7-2)9-8-11(5)10(3)4;1-3-2;2*1-2/h6,10H,5,7-9H2,1-4H3;3H,1H2,2H3;2*1-2H3/b12-6-;;; |
| InChIKey | CRDHGWIFWNHHAZ-SFFSSGGOSA-N |
| XLogP | 7.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 268.53 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;(Z)-3-ethyl-7-methyl-6-methylideneoct-2-ene;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(Z)-3-ethyl-7-methyl-6-methylideneoct-2-ene;prop-1-ene?
The IUPAC name of ethane;(Z)-3-ethyl-7-methyl-6-methylideneoct-2-ene;prop-1-ene (CID 178040036) is ethane;(Z)-3-ethyl-7-methyl-6-methylideneoct-2-ene;prop-1-ene.
What is the SMILES notation for ethane;(Z)-3-ethyl-7-methyl-6-methylideneoct-2-ene;prop-1-ene?
The canonical SMILES for ethane;(Z)-3-ethyl-7-methyl-6-methylideneoct-2-ene;prop-1-ene is C=C(CC/C(=C\C)CC)C(C)C.C=CC.CC.CC.
What is the InChIKey of ethane;(Z)-3-ethyl-7-methyl-6-methylideneoct-2-ene;prop-1-ene?
The InChIKey is CRDHGWIFWNHHAZ-SFFSSGGOSA-N. The full InChI is InChI=1S/C12H22.C3H6.2C2H6/c1-6-12(7-2)9-8-11(5)10(3)4;1-3-2;2*1-2/h6,10H,5,7-9H2,1-4H3;3H,1H2,2H3;2*1-2H3/b12-6-;;;.
What are the key properties of ethane;(Z)-3-ethyl-7-methyl-6-methylideneoct-2-ene;prop-1-ene?
ethane;(Z)-3-ethyl-7-methyl-6-methylideneoct-2-ene;prop-1-ene has a molecular weight of 268.53 g/mol, XLogP of 7.58, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(Z)-3-ethyl-7-methyl-6-methylideneoct-2-ene;prop-1-ene is sourced from PubChem (CID 178040036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).