C11H20S — CID 129154835
2,7-dimethyl-6-methylideneoctane-3-thione (PubChem CID 129154835) has the molecular formula C11H20S and a molecular weight of 184.35 g/mol. Its IUPAC name is 2,7-dimethyl-6-methylideneoctane-3-thione.
| Compound Name | 2,7-dimethyl-6-methylideneoctane-3-thione |
|---|---|
| PubChem CID | 129154835 |
| Molecular Formula | C11H20S |
| Molecular Weight | 184.35 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | 2,7-dimethyl-6-methylideneoctane-3-thione |
| SMILES | C=C(CCC(=S)C(C)C)C(C)C |
| InChI | InChI=1S/C11H20S/c1-8(2)10(5)6-7-11(12)9(3)4/h8-9H,5-7H2,1-4H3 |
| InChIKey | QEDNZCLHDNPAIY-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.35 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|