C23H45N — CID 155245297
N,13-dimethyl-12-methylidene-N-(3-methylpent-1-en-2-yl)tetradecan-1-amine (PubChem CID 155245297) has the molecular formula C23H45N and a molecular weight of 335.62 g/mol. Its IUPAC name is N,13-dimethyl-12-methylidene-N-(3-methylpent-1-en-2-yl)tetradecan-1-amine.
| Compound Name | N,13-dimethyl-12-methylidene-N-(3-methylpent-1-en-2-yl)tetradecan-1-amine |
|---|---|
| PubChem CID | 155245297 |
| Molecular Formula | C23H45N |
| Molecular Weight | 335.62 g/mol |
| Exact Mass | 335.36 |
| IUPAC Name | N,13-dimethyl-12-methylidene-N-(3-methylpent-1-en-2-yl)tetradecan-1-amine |
| SMILES | C=C(CCCCCCCCCCCN(C)C(=C)C(C)CC)C(C)C |
| InChI | InChI=1S/C23H45N/c1-8-21(4)23(6)24(7)19-17-15-13-11-9-10-12-14-16-18-22(5)20(2)3/h20-21H,5-6,8-19H2,1-4,7H3 |
| InChIKey | VUOBTPOEHUUPGX-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.62 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|