About N'-methyl-N'-(3-methylbut-1-en-2-yl)-N-propylpentane-1,5-diamine
N'-methyl-N'-(3-methylbut-1-en-2-yl)-N-propylpentane-1,5-diamine (PubChem CID 166678487) has the molecular formula C14H30N2
and a molecular weight of 226.41 g/mol. Its IUPAC name is N'-methyl-N'-(3-methylbut-1-en-2-yl)-N-propylpentane-1,5-diamine.
Molecular Properties
| Compound Name | N'-methyl-N'-(3-methylbut-1-en-2-yl)-N-propylpentane-1,5-diamine |
| PubChem CID | 166678487 |
| Molecular Formula | C14H30N2 |
| Molecular Weight | 226.41 g/mol |
| Exact Mass | 226.24 |
| IUPAC Name | N'-methyl-N'-(3-methylbut-1-en-2-yl)-N-propylpentane-1,5-diamine |
| SMILES | C=C(C(C)C)N(C)CCCCCNCCC |
| InChI | InChI=1S/C14H30N2/c1-6-10-15-11-8-7-9-12-16(5)14(4)13(2)3/h13,15H,4,6-12H2,1-3,5H3 |
| InChIKey | YUSJOJJLNRUWHF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.41 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-methyl-N'-(3-methylbut-1-en-2-yl)-N-propylpentane-1,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methyl-N'-(3-methylbut-1-en-2-yl)-N-propylpentane-1,5-diamine?
The IUPAC name of N'-methyl-N'-(3-methylbut-1-en-2-yl)-N-propylpentane-1,5-diamine (CID 166678487) is N'-methyl-N'-(3-methylbut-1-en-2-yl)-N-propylpentane-1,5-diamine.
What is the SMILES notation for N'-methyl-N'-(3-methylbut-1-en-2-yl)-N-propylpentane-1,5-diamine?
The canonical SMILES for N'-methyl-N'-(3-methylbut-1-en-2-yl)-N-propylpentane-1,5-diamine is C=C(C(C)C)N(C)CCCCCNCCC.
What is the InChIKey of N'-methyl-N'-(3-methylbut-1-en-2-yl)-N-propylpentane-1,5-diamine?
The InChIKey is YUSJOJJLNRUWHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30N2/c1-6-10-15-11-8-7-9-12-16(5)14(4)13(2)3/h13,15H,4,6-12H2,1-3,5H3.
What are the key properties of N'-methyl-N'-(3-methylbut-1-en-2-yl)-N-propylpentane-1,5-diamine?
N'-methyl-N'-(3-methylbut-1-en-2-yl)-N-propylpentane-1,5-diamine has a molecular weight of 226.41 g/mol, XLogP of 3.26, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methyl-N'-(3-methylbut-1-en-2-yl)-N-propylpentane-1,5-diamine is sourced from PubChem (CID 166678487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).