C18H37N — CID 166770577
N,2,2,9-tetramethyl-8-methylidene-N-propan-2-yldecan-1-amine (PubChem CID 166770577) has the molecular formula C18H37N and a molecular weight of 267.50 g/mol. Its IUPAC name is N,2,2,9-tetramethyl-8-methylidene-N-propan-2-yldecan-1-amine.
| Compound Name | N,2,2,9-tetramethyl-8-methylidene-N-propan-2-yldecan-1-amine |
|---|---|
| PubChem CID | 166770577 |
| Molecular Formula | C18H37N |
| Molecular Weight | 267.50 g/mol |
| Exact Mass | 267.29 |
| IUPAC Name | N,2,2,9-tetramethyl-8-methylidene-N-propan-2-yldecan-1-amine |
| SMILES | C=C(CCCCCC(C)(C)CN(C)C(C)C)C(C)C |
| InChI | InChI=1S/C18H37N/c1-15(2)17(5)12-10-9-11-13-18(6,7)14-19(8)16(3)4/h15-16H,5,9-14H2,1-4,6-8H3 |
| InChIKey | RFGXBIFXMYFRQO-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.50 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|