C18H37N — CID 170848016
N,N,4-trimethylpentadec-1-en-6-amine (PubChem CID 170848016) has the molecular formula C18H37N and a molecular weight of 267.50 g/mol. Its IUPAC name is N,N,4-trimethylpentadec-1-en-6-amine.
| Compound Name | N,N,4-trimethylpentadec-1-en-6-amine |
|---|---|
| PubChem CID | 170848016 |
| Molecular Formula | C18H37N |
| Molecular Weight | 267.50 g/mol |
| Exact Mass | 267.29 |
| IUPAC Name | N,N,4-trimethylpentadec-1-en-6-amine |
| SMILES | C=CCC(C)CC(CCCCCCCCC)N(C)C |
| InChI | InChI=1S/C18H37N/c1-6-8-9-10-11-12-13-15-18(19(4)5)16-17(3)14-7-2/h7,17-18H,2,6,8-16H2,1,3-5H3 |
| InChIKey | JZAKKIKPXUTOJU-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.50 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|