C26H50FN — CID 170075652
N-(6-fluorooctan-4-yl)-N-methyl-11-methylidene-7-propyltridec-12-en-6-amine (PubChem CID 170075652) has the molecular formula C26H50FN and a molecular weight of 395.69 g/mol. Its IUPAC name is N-(6-fluorooctan-4-yl)-N-methyl-11-methylidene-7-propyltridec-12-en-6-amine.
| Compound Name | N-(6-fluorooctan-4-yl)-N-methyl-11-methylidene-7-propyltridec-12-en-6-amine |
|---|---|
| PubChem CID | 170075652 |
| Molecular Formula | C26H50FN |
| Molecular Weight | 395.69 g/mol |
| Exact Mass | 395.39 |
| IUPAC Name | N-(6-fluorooctan-4-yl)-N-methyl-11-methylidene-7-propyltridec-12-en-6-amine |
| SMILES | C=CC(=C)CCCC(CCC)C(CCCCC)N(C)C(CCC)CC(F)CC |
| InChI | InChI=1S/C26H50FN/c1-8-13-14-20-26(23(16-9-2)19-15-18-22(6)11-4)28(7)25(17-10-3)21-24(27)12-5/h11,23-26H,4,6,8-10,12-21H2,1-3,5,7H3 |
| InChIKey | VXJKPJUQPXVFED-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.69 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|