C22H45N — CID 170848029
N,N-dimethyl-8-pentylpentadec-10-en-6-amine (PubChem CID 170848029) has the molecular formula C22H45N and a molecular weight of 323.61 g/mol. Its IUPAC name is N,N-dimethyl-8-pentylpentadec-10-en-6-amine.
| Compound Name | N,N-dimethyl-8-pentylpentadec-10-en-6-amine |
|---|---|
| PubChem CID | 170848029 |
| Molecular Formula | C22H45N |
| Molecular Weight | 323.61 g/mol |
| Exact Mass | 323.36 |
| IUPAC Name | N,N-dimethyl-8-pentylpentadec-10-en-6-amine |
| SMILES | CCCCC=CCC(CCCCC)CC(CCCCC)N(C)C |
| InChI | InChI=1S/C22H45N/c1-6-9-12-13-16-18-21(17-14-10-7-2)20-22(23(4)5)19-15-11-8-3/h13,16,21-22H,6-12,14-15,17-20H2,1-5H3 |
| InChIKey | CAZCDITWIPEBSV-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.61 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|