C16H33N — CID 170848026
N,N-dimethyl-6-propylundec-7-en-4-amine (PubChem CID 170848026) has the molecular formula C16H33N and a molecular weight of 239.45 g/mol. Its IUPAC name is N,N-dimethyl-6-propylundec-7-en-4-amine.
| Compound Name | N,N-dimethyl-6-propylundec-7-en-4-amine |
|---|---|
| PubChem CID | 170848026 |
| Molecular Formula | C16H33N |
| Molecular Weight | 239.45 g/mol |
| Exact Mass | 239.26 |
| IUPAC Name | N,N-dimethyl-6-propylundec-7-en-4-amine |
| SMILES | CCCC=CC(CCC)CC(CCC)N(C)C |
| InChI | InChI=1S/C16H33N/c1-6-9-10-13-15(11-7-2)14-16(12-8-3)17(4)5/h10,13,15-16H,6-9,11-12,14H2,1-5H3 |
| InChIKey | NFISZEMWMYYWSX-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.45 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|