C20H41N — CID 123204821
N-butyl-3,7-diethyl-N-methyl-8-methylidenedecan-2-amine (PubChem CID 123204821) has the molecular formula C20H41N and a molecular weight of 295.56 g/mol. Its IUPAC name is N-butyl-3,7-diethyl-N-methyl-8-methylidenedecan-2-amine.
| Compound Name | N-butyl-3,7-diethyl-N-methyl-8-methylidenedecan-2-amine |
|---|---|
| PubChem CID | 123204821 |
| Molecular Formula | C20H41N |
| Molecular Weight | 295.56 g/mol |
| Exact Mass | 295.32 |
| IUPAC Name | N-butyl-3,7-diethyl-N-methyl-8-methylidenedecan-2-amine |
| SMILES | C=C(CC)C(CC)CCCC(CC)C(C)N(C)CCCC |
| InChI | InChI=1S/C20H41N/c1-8-12-16-21(7)18(6)20(11-4)15-13-14-19(10-3)17(5)9-2/h18-20H,5,8-16H2,1-4,6-7H3 |
| InChIKey | UJFWEBFGXKNIMH-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.56 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|