C9H18O — CID 5366237
(Z)-4,5-dimethylhept-2-en-3-ol (PubChem CID 5366237) has the molecular formula C9H18O and a molecular weight of 142.24 g/mol. Its IUPAC name is (Z)-4,5-dimethylhept-2-en-3-ol.
| Compound Name | (Z)-4,5-dimethylhept-2-en-3-ol |
|---|---|
| PubChem CID | 5366237 |
| Molecular Formula | C9H18O |
| Molecular Weight | 142.24 g/mol |
| Exact Mass | 142.14 |
| IUPAC Name | (Z)-4,5-dimethylhept-2-en-3-ol |
| SMILES | C/C=C(\O)C(C)C(C)CC |
| InChI | InChI=1S/C9H18O/c1-5-7(3)8(4)9(10)6-2/h6-8,10H,5H2,1-4H3/b9-6- |
| InChIKey | HYWAFUMZYFOODP-TWGQIWQCSA-N |
| XLogP | 3.13 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.24 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|