C12H22O2 — CID 76672886
1-but-2-enoxy-3,4-dimethylhexan-2-one (PubChem CID 76672886) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is 1-but-2-enoxy-3,4-dimethylhexan-2-one.
| Compound Name | 1-but-2-enoxy-3,4-dimethylhexan-2-one |
|---|---|
| PubChem CID | 76672886 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | 1-but-2-enoxy-3,4-dimethylhexan-2-one |
| SMILES | CC=CCOCC(=O)C(C)C(C)CC |
| InChI | InChI=1S/C12H22O2/c1-5-7-8-14-9-12(13)11(4)10(3)6-2/h5,7,10-11H,6,8-9H2,1-4H3 |
| InChIKey | RWMORBRBPQEHKE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|