C9H13N — CID 147215892
(2E,4Z)-2-propan-2-ylhexa-2,4-dienenitrile (PubChem CID 147215892) has the molecular formula C9H13N and a molecular weight of 135.21 g/mol. Its IUPAC name is (2E,4Z)-2-propan-2-ylhexa-2,4-dienenitrile.
| Compound Name | (2E,4Z)-2-propan-2-ylhexa-2,4-dienenitrile |
|---|---|
| PubChem CID | 147215892 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | (2E,4Z)-2-propan-2-ylhexa-2,4-dienenitrile |
| SMILES | C/C=C\C=C(\C#N)C(C)C |
| InChI | InChI=1S/C9H13N/c1-4-5-6-9(7-10)8(2)3/h4-6,8H,1-3H3/b5-4-,9-6- |
| InChIKey | CGCMQHRDXYEZBX-WXOLFVLTSA-N |
| XLogP | 2.67 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|