C9H14N2 — CID 129033463
(2E)-2-(1-aminoethyl)-5-methylhexa-2,4-dienenitrile (PubChem CID 129033463) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is (2E)-2-(1-aminoethyl)-5-methylhexa-2,4-dienenitrile.
| Compound Name | (2E)-2-(1-aminoethyl)-5-methylhexa-2,4-dienenitrile |
|---|---|
| PubChem CID | 129033463 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | (2E)-2-(1-aminoethyl)-5-methylhexa-2,4-dienenitrile |
| SMILES | CC(C)=C/C=C(/C#N)C(C)N |
| InChI | InChI=1S/C9H14N2/c1-7(2)4-5-9(6-10)8(3)11/h4-5,8H,11H2,1-3H3/b9-5- |
| InChIKey | PCVCMXAZWBPURO-UITAMQMPSA-N |
| XLogP | 1.75 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|