About 1-(3-methylbut-2-enylidene-λ3-iodanyl)ethanamine
1-(3-methylbut-2-enylidene-λ3-iodanyl)ethanamine (PubChem CID 163780323) has the molecular formula C7H14IN
and a molecular weight of 239.10 g/mol. Its IUPAC name is 1-(3-methylbut-2-enylidene-λ3-iodanyl)ethanamine.
Molecular Properties
| Compound Name | 1-(3-methylbut-2-enylidene-λ3-iodanyl)ethanamine |
| PubChem CID | 163780323 |
| Molecular Formula | C7H14IN |
| Molecular Weight | 239.10 g/mol |
| Exact Mass | 239.02 |
| IUPAC Name | 1-(3-methylbut-2-enylidene-λ3-iodanyl)ethanamine |
| SMILES | CC(C)=C/C=I/C(C)N |
| InChI | InChI=1S/C7H14IN/c1-6(2)4-5-8-7(3)9/h4-5,7H,9H2,1-3H3 |
| InChIKey | MOAOMGRPVIMETA-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.10 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-methylbut-2-enylidene-λ3-iodanyl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-methylbut-2-enylidene-λ3-iodanyl)ethanamine?
The IUPAC name of 1-(3-methylbut-2-enylidene-λ3-iodanyl)ethanamine (CID 163780323) is 1-(3-methylbut-2-enylidene-λ3-iodanyl)ethanamine.
What is the SMILES notation for 1-(3-methylbut-2-enylidene-λ3-iodanyl)ethanamine?
The canonical SMILES for 1-(3-methylbut-2-enylidene-λ3-iodanyl)ethanamine is CC(C)=C/C=I/C(C)N.
What is the InChIKey of 1-(3-methylbut-2-enylidene-λ3-iodanyl)ethanamine?
The InChIKey is MOAOMGRPVIMETA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14IN/c1-6(2)4-5-8-7(3)9/h4-5,7H,9H2,1-3H3.
What are the key properties of 1-(3-methylbut-2-enylidene-λ3-iodanyl)ethanamine?
1-(3-methylbut-2-enylidene-λ3-iodanyl)ethanamine has a molecular weight of 239.10 g/mol, XLogP of 2.03, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-methylbut-2-enylidene-λ3-iodanyl)ethanamine is sourced from PubChem (CID 163780323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).