C8H15N — CID 123570929
4-methylhepta-3,5-dien-2-amine (PubChem CID 123570929) has the molecular formula C8H15N and a molecular weight of 125.21 g/mol. Its IUPAC name is 4-methylhepta-3,5-dien-2-amine.
| Compound Name | 4-methylhepta-3,5-dien-2-amine |
|---|---|
| PubChem CID | 123570929 |
| Molecular Formula | C8H15N |
| Molecular Weight | 125.21 g/mol |
| Exact Mass | 125.12 |
| IUPAC Name | 4-methylhepta-3,5-dien-2-amine |
| SMILES | CC=CC(C)=CC(C)N |
| InChI | InChI=1S/C8H15N/c1-4-5-7(2)6-8(3)9/h4-6,8H,9H2,1-3H3 |
| InChIKey | NOLRCULNCHNNQP-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.21 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|