C7H12ClN — CID 134365778
(3E,5Z)-4-chlorohepta-3,5-dien-2-amine (PubChem CID 134365778) has the molecular formula C7H12ClN and a molecular weight of 145.63 g/mol. Its IUPAC name is (3E,5Z)-4-chlorohepta-3,5-dien-2-amine.
| Compound Name | (3E,5Z)-4-chlorohepta-3,5-dien-2-amine |
|---|---|
| PubChem CID | 134365778 |
| Molecular Formula | C7H12ClN |
| Molecular Weight | 145.63 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | (3E,5Z)-4-chlorohepta-3,5-dien-2-amine |
| SMILES | C/C=C\C(Cl)=C/C(C)N |
| InChI | InChI=1S/C7H12ClN/c1-3-4-7(8)5-6(2)9/h3-6H,9H2,1-2H3/b4-3-,7-5+ |
| InChIKey | NEMDPSHJYRYITR-QVXLNCAUSA-N |
| XLogP | 2.03 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.63 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|