C7H15NO — CID 163696566
(E,5R)-5-amino-2-methylhex-3-en-3-ol (PubChem CID 163696566) has the molecular formula C7H15NO and a molecular weight of 129.20 g/mol. Its IUPAC name is (E,5R)-5-amino-2-methylhex-3-en-3-ol.
| Compound Name | (E,5R)-5-amino-2-methylhex-3-en-3-ol |
|---|---|
| PubChem CID | 163696566 |
| Molecular Formula | C7H15NO |
| Molecular Weight | 129.20 g/mol |
| Exact Mass | 129.12 |
| IUPAC Name | (E,5R)-5-amino-2-methylhex-3-en-3-ol |
| SMILES | CC(C)/C(O)=C\[C@@H](C)N |
| InChI | InChI=1S/C7H15NO/c1-5(2)7(9)4-6(3)8/h4-6,9H,8H2,1-3H3/b7-4+/t6-/m1/s1 |
| InChIKey | JXLYQIJMMZUYPB-LTYDNXFVSA-N |
| XLogP | 1.43 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.20 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|