C8H16O — CID 59212039
(Z)-2,5-dimethylhex-3-en-3-ol (PubChem CID 59212039) has the molecular formula C8H16O and a molecular weight of 128.21 g/mol. Its IUPAC name is (Z)-2,5-dimethylhex-3-en-3-ol.
| Compound Name | (Z)-2,5-dimethylhex-3-en-3-ol |
|---|---|
| PubChem CID | 59212039 |
| Molecular Formula | C8H16O |
| Molecular Weight | 128.21 g/mol |
| Exact Mass | 128.12 |
| IUPAC Name | (Z)-2,5-dimethylhex-3-en-3-ol |
| SMILES | CC(C)/C=C(\O)C(C)C |
| InChI | InChI=1S/C8H16O/c1-6(2)5-8(9)7(3)4/h5-7,9H,1-4H3/b8-5- |
| InChIKey | NTJFZUYBPIRSIG-YVMONPNESA-N |
| XLogP | 2.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.21 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|