About (Z)-2,5-dimethylhex-3-en-3-ol
(Z)-2,5-dimethylhex-3-en-3-ol (PubChem CID 59212039) has the molecular formula C8H16O
and a molecular weight of 128.21 g/mol. Its IUPAC name is (Z)-2,5-dimethylhex-3-en-3-ol.
Molecular Properties
| Compound Name | (Z)-2,5-dimethylhex-3-en-3-ol |
| PubChem CID | 59212039 |
| Molecular Formula | C8H16O |
| Molecular Weight | 128.21 g/mol |
| Exact Mass | 128.12 |
| IUPAC Name | (Z)-2,5-dimethylhex-3-en-3-ol |
| SMILES | CC(C)/C=C(\O)C(C)C |
| InChI | InChI=1S/C8H16O/c1-6(2)5-8(9)7(3)4/h5-7,9H,1-4H3/b8-5- |
| InChIKey | NTJFZUYBPIRSIG-YVMONPNESA-N |
| XLogP | 2.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.21 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2,5-dimethylhex-3-en-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2,5-dimethylhex-3-en-3-ol?
The IUPAC name of (Z)-2,5-dimethylhex-3-en-3-ol (CID 59212039) is (Z)-2,5-dimethylhex-3-en-3-ol.
What is the SMILES notation for (Z)-2,5-dimethylhex-3-en-3-ol?
The canonical SMILES for (Z)-2,5-dimethylhex-3-en-3-ol is CC(C)/C=C(\O)C(C)C.
What is the InChIKey of (Z)-2,5-dimethylhex-3-en-3-ol?
The InChIKey is NTJFZUYBPIRSIG-YVMONPNESA-N. The full InChI is InChI=1S/C8H16O/c1-6(2)5-8(9)7(3)4/h5-7,9H,1-4H3/b8-5-.
What are the key properties of (Z)-2,5-dimethylhex-3-en-3-ol?
(Z)-2,5-dimethylhex-3-en-3-ol has a molecular weight of 128.21 g/mol, XLogP of 2.74, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2,5-dimethylhex-3-en-3-ol is sourced from PubChem (CID 59212039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).