C5H10O2 — CID 89150203
3-methyl(2,3-11C2)but-1-ene-1,1-diol (PubChem CID 89150203) has the molecular formula C5H10O2 and a molecular weight of 100.13 g/mol. Its IUPAC name is 3-methyl(2,3-11C2)but-1-ene-1,1-diol.
| Compound Name | 3-methyl(2,3-11C2)but-1-ene-1,1-diol |
|---|---|
| PubChem CID | 89150203 |
| Molecular Formula | C5H10O2 |
| Molecular Weight | 100.13 g/mol |
| Exact Mass | 100.09 |
| IUPAC Name | 3-methyl(2,3-11C2)but-1-ene-1,1-diol |
| SMILES | C[11CH](C)[11CH]=C(O)O |
| InChI | InChI=1S/C5H10O2/c1-4(2)3-5(6)7/h3-4,6-7H,1-2H3/i3-1,4-1 |
| InChIKey | NLJSOOYMEWHJJJ-QNGFNXCSSA-N |
| XLogP | 1.60 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 100.13 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|