C10H16O — CID 130754932
5,7-dimethylocta-3,5-dien-2-one (PubChem CID 130754932) has the molecular formula C10H16O and a molecular weight of 152.24 g/mol. Its IUPAC name is 5,7-dimethylocta-3,5-dien-2-one.
| Compound Name | 5,7-dimethylocta-3,5-dien-2-one |
|---|---|
| PubChem CID | 130754932 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | 5,7-dimethylocta-3,5-dien-2-one |
| SMILES | CC(=O)C=CC(C)=CC(C)C |
| InChI | InChI=1S/C10H16O/c1-8(2)7-9(3)5-6-10(4)11/h5-8H,1-4H3 |
| InChIKey | MAFXMOBULWEZLH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|