C12H20O3 — CID 102506726
(3E,5E,7S,8R)-8-hydroxy-7-(hydroxymethyl)-5-methyldeca-3,5-dien-2-one (PubChem CID 102506726) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is (3E,5E,7S,8R)-8-hydroxy-7-(hydroxymethyl)-5-methyldeca-3,5-dien-2-one.
| Compound Name | (3E,5E,7S,8R)-8-hydroxy-7-(hydroxymethyl)-5-methyldeca-3,5-dien-2-one |
|---|---|
| PubChem CID | 102506726 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | (3E,5E,7S,8R)-8-hydroxy-7-(hydroxymethyl)-5-methyldeca-3,5-dien-2-one |
| SMILES | CC[C@@H](O)[C@@H](/C=C(C)/C=C/C(C)=O)CO |
| InChI | InChI=1S/C12H20O3/c1-4-12(15)11(8-13)7-9(2)5-6-10(3)14/h5-7,11-13,15H,4,8H2,1-3H3/b6-5+,9-7+/t11-,12+/m0/s1 |
| InChIKey | GBKPXGVRXZKIHP-BHGKFCARSA-N |
| XLogP | 1.46 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|