C20H30O4 — CID 123339000
(3E,7E,9E,11E,13S,14S,16S)-13,14,16-trihydroxy-5,7,11-trimethylheptadeca-3,5,7,9,11-pentaen-2-one (PubChem CID 123339000) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is (3E,7E,9E,11E,13S,14S,16S)-13,14,16-trihydroxy-5,7,11-trimethylheptadeca-3,5,7,9,11-pentaen-2-one.
| Compound Name | (3E,7E,9E,11E,13S,14S,16S)-13,14,16-trihydroxy-5,7,11-trimethylheptadeca-3,5,7,9,11-pentaen-2-one |
|---|---|
| PubChem CID | 123339000 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | (3E,7E,9E,11E,13S,14S,16S)-13,14,16-trihydroxy-5,7,11-trimethylheptadeca-3,5,7,9,11-pentaen-2-one |
| SMILES | CC(=O)/C=C/C(C)=C/C(C)=C/C=C/C(C)=C/[C@H](O)[C@@H](O)C[C@H](C)O |
| InChI | InChI=1S/C20H30O4/c1-14(11-16(3)9-10-17(4)21)7-6-8-15(2)12-19(23)20(24)13-18(5)22/h6-12,18-20,22-24H,13H2,1-5H3/b8-6+,10-9+,14-7+,15-12+,16-11?/t18-,19-,20-/m0/s1 |
| InChIKey | KJERHYBWPOMUGX-OPXDDGMMSA-N |
| XLogP | 3.02 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|