C34H56O5 — CID 130238883
[(E,6S)-6,12-dimethyltridec-8-en-5-yl] (2E,4E,6E,8E,10E)-12,15-dihydroxy-13-(hydroxymethyl)-4,10-dimethylhexadeca-2,4,6,8,10-pentaenoate (PubChem CID 130238883) has the molecular formula C34H56O5 and a molecular weight of 544.82 g/mol. Its IUPAC name is [(E,6S)-6,12-dimethyltridec-8-en-5-yl] (2E,4E,6E,8E,10E)-12,15-dihydroxy-13-(hydroxymethyl)-4,10-dimethylhexadeca-2,4,6,8,10-pentaenoate.
| Compound Name | [(E,6S)-6,12-dimethyltridec-8-en-5-yl] (2E,4E,6E,8E,10E)-12,15-dihydroxy-13-(hydroxymethyl)-4,10-dimethylhexadeca-2,4,6,8,10-pentaenoate |
|---|---|
| PubChem CID | 130238883 |
| Molecular Formula | C34H56O5 |
| Molecular Weight | 544.82 g/mol |
| Exact Mass | 544.41 |
| IUPAC Name | [(E,6S)-6,12-dimethyltridec-8-en-5-yl] (2E,4E,6E,8E,10E)-12,15-dihydroxy-13-(hydroxymethyl)-4,10-dimethylhexadeca-2,4,6,8,10-pentaenoate |
| SMILES | CCCCC(OC(=O)/C=C/C(C)=C/C=C/C=C/C(C)=C/C(O)C(CO)CC(C)O)[C@@H](C)C/C=C/CCC(C)C |
| InChI | InChI=1S/C34H56O5/c1-8-9-20-33(29(6)19-15-10-12-16-26(2)3)39-34(38)22-21-27(4)17-13-11-14-18-28(5)23-32(37)31(25-35)24-30(7)36/h10-11,13-15,17-18,21-23,26,29-33,35-37H,8-9,12,16,19-20,24-25H2,1-7H3/b13-11+,15-10+,18-14+,22-21+,27-17+,28-23+/t29-,30?,31?,32?,33?/m0/s1 |
| InChIKey | USIIDDGZKVABDV-USPDMMDQSA-N |
| XLogP | 7.41 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.82 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|