C19H24O5 — CID 126683740
(E)-3-[3-[(1E,3E,5S,6S,8S)-5,6,8-trihydroxy-3-methylnona-1,3-dienyl]phenyl]prop-2-enoic acid (PubChem CID 126683740) has the molecular formula C19H24O5 and a molecular weight of 332.40 g/mol. Its IUPAC name is (E)-3-[3-[(1E,3E,5S,6S,8S)-5,6,8-trihydroxy-3-methylnona-1,3-dienyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[(1E,3E,5S,6S,8S)-5,6,8-trihydroxy-3-methylnona-1,3-dienyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 126683740 |
| Molecular Formula | C19H24O5 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | (E)-3-[3-[(1E,3E,5S,6S,8S)-5,6,8-trihydroxy-3-methylnona-1,3-dienyl]phenyl]prop-2-enoic acid |
| SMILES | CC(/C=C/c1cccc(/C=C/C(=O)O)c1)=C\[C@H](O)[C@@H](O)C[C@H](C)O |
| InChI | InChI=1S/C19H24O5/c1-13(10-17(21)18(22)11-14(2)20)6-7-15-4-3-5-16(12-15)8-9-19(23)24/h3-10,12,14,17-18,20-22H,11H2,1-2H3,(H,23,24)/b7-6+,9-8+,13-10+/t14-,17-,18-/m0/s1 |
| InChIKey | HENWZWHPNVADJI-NVWFNBLFSA-N |
| XLogP | 2.24 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|