About 2-oxopropanethial
2-oxopropanethial (PubChem CID 18364311) has the molecular formula C3H4OS
and a molecular weight of 88.13 g/mol. Its IUPAC name is 2-oxopropanethial.
Molecular Properties
| Compound Name | 2-oxopropanethial |
| PubChem CID | 18364311 |
| Molecular Formula | C3H4OS |
| Molecular Weight | 88.13 g/mol |
| Exact Mass | 88.00 |
| IUPAC Name | 2-oxopropanethial |
| SMILES | CC(=O)C=S |
| InChI | InChI=1S/C3H4OS/c1-3(4)2-5/h2H,1H3 |
| InChIKey | UDJRRTLNYAVBKG-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 88.13 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-oxopropanethial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxopropanethial?
The IUPAC name of 2-oxopropanethial (CID 18364311) is 2-oxopropanethial.
What is the SMILES notation for 2-oxopropanethial?
The canonical SMILES for 2-oxopropanethial is CC(=O)C=S.
What is the InChIKey of 2-oxopropanethial?
The InChIKey is UDJRRTLNYAVBKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4OS/c1-3(4)2-5/h2H,1H3.
What are the key properties of 2-oxopropanethial?
2-oxopropanethial has a molecular weight of 88.13 g/mol, XLogP of 0.58, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxopropanethial is sourced from PubChem (CID 18364311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).