About oxaldehyde;2-oxopropanal
oxaldehyde;2-oxopropanal (PubChem CID 22114514) has the molecular formula C5H6O4
and a molecular weight of 130.10 g/mol. Its IUPAC name is oxaldehyde;2-oxopropanal.
Molecular Properties
| Compound Name | oxaldehyde;2-oxopropanal |
| PubChem CID | 22114514 |
| Molecular Formula | C5H6O4 |
| Molecular Weight | 130.10 g/mol |
| Exact Mass | 130.03 |
| IUPAC Name | oxaldehyde;2-oxopropanal |
| SMILES | CC(=O)C=O.O=CC=O |
| InChI | InChI=1S/C3H4O2.C2H2O2/c1-3(5)2-4;3-1-2-4/h2H,1H3;1-2H |
| InChIKey | RAGHYEDMWUCFQM-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.10 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze oxaldehyde;2-oxopropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxaldehyde;2-oxopropanal?
The IUPAC name of oxaldehyde;2-oxopropanal (CID 22114514) is oxaldehyde;2-oxopropanal.
What is the SMILES notation for oxaldehyde;2-oxopropanal?
The canonical SMILES for oxaldehyde;2-oxopropanal is CC(=O)C=O.O=CC=O.
What is the InChIKey of oxaldehyde;2-oxopropanal?
The InChIKey is RAGHYEDMWUCFQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4O2.C2H2O2/c1-3(5)2-4;3-1-2-4/h2H,1H3;1-2H.
What are the key properties of oxaldehyde;2-oxopropanal?
oxaldehyde;2-oxopropanal has a molecular weight of 130.10 g/mol, XLogP of -0.84, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for oxaldehyde;2-oxopropanal is sourced from PubChem (CID 22114514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).