About 2-methylprop-2-enethial
2-methylprop-2-enethial (PubChem CID 54224376) has the molecular formula C4H6S
and a molecular weight of 86.16 g/mol. Its IUPAC name is 2-methylprop-2-enethial.
Molecular Properties
| Compound Name | 2-methylprop-2-enethial |
| PubChem CID | 54224376 |
| Molecular Formula | C4H6S |
| Molecular Weight | 86.16 g/mol |
| Exact Mass | 86.02 |
| IUPAC Name | 2-methylprop-2-enethial |
| SMILES | C=C(C)C=S |
| InChI | InChI=1S/C4H6S/c1-4(2)3-5/h3H,1H2,2H3 |
| InChIKey | XICPRGTYEKESJK-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 86.16 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-2-enethial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-2-enethial?
The IUPAC name of 2-methylprop-2-enethial (CID 54224376) is 2-methylprop-2-enethial.
What is the SMILES notation for 2-methylprop-2-enethial?
The canonical SMILES for 2-methylprop-2-enethial is C=C(C)C=S.
What is the InChIKey of 2-methylprop-2-enethial?
The InChIKey is XICPRGTYEKESJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6S/c1-4(2)3-5/h3H,1H2,2H3.
What are the key properties of 2-methylprop-2-enethial?
2-methylprop-2-enethial has a molecular weight of 86.16 g/mol, XLogP of 1.56, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-2-enethial is sourced from PubChem (CID 54224376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).